C26H22O8 — CID 97488889
methyl (3R)-3-(2-methoxyphenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate (PubChem CID 97488889) has the molecular formula C26H22O8 and a molecular weight of 462.45 g/mol. Its IUPAC name is methyl (3R)-3-(2-methoxyphenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate.
| Compound Name | methyl (3R)-3-(2-methoxyphenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
|---|---|
| PubChem CID | 97488889 |
| Molecular Formula | C26H22O8 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | methyl (3R)-3-(2-methoxyphenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
| SMILES | COC(=O)C[C@H](c1ccccc1OC)c1c(O)c(O)c(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C26H22O8/c1-32-18-11-7-6-10-15(18)16(12-20(28)33-2)21-23(29)25(31)24(30)22-17(27)13-19(34-26(21)22)14-8-4-3-5-9-14/h3-11,13,16,29-31H,12H2,1-2H3/t16-/m1/s1 |
| InChIKey | ZBBBEYSVHPWXAR-MRXNPFEDSA-N |
| XLogP | 4.28 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|