C32H27NO10 — CID 99987389
5,6,7-trihydroxy-8-[(1R)-1-(6-methoxy-4-oxochromen-3-yl)-3-morpholin-4-yl-3-oxopropyl]-2-phenylchromen-4-one (PubChem CID 99987389) has the molecular formula C32H27NO10 and a molecular weight of 585.57 g/mol. Its IUPAC name is 5,6,7-trihydroxy-8-[(1R)-1-(6-methoxy-4-oxochromen-3-yl)-3-morpholin-4-yl-3-oxopropyl]-2-phenylchromen-4-one.
| Compound Name | 5,6,7-trihydroxy-8-[(1R)-1-(6-methoxy-4-oxochromen-3-yl)-3-morpholin-4-yl-3-oxopropyl]-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 99987389 |
| Molecular Formula | C32H27NO10 |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | 5,6,7-trihydroxy-8-[(1R)-1-(6-methoxy-4-oxochromen-3-yl)-3-morpholin-4-yl-3-oxopropyl]-2-phenylchromen-4-one |
| SMILES | COc1ccc2occ([C@H](CC(=O)N3CCOCC3)c3c(O)c(O)c(O)c4c(=O)cc(-c5ccccc5)oc34)c(=O)c2c1 |
| InChI | InChI=1S/C32H27NO10/c1-40-18-7-8-23-20(13-18)28(36)21(16-42-23)19(14-25(35)33-9-11-41-12-10-33)26-29(37)31(39)30(38)27-22(34)15-24(43-32(26)27)17-5-3-2-4-6-17/h2-8,13,15-16,19,37-39H,9-12,14H2,1H3/t19-/m0/s1 |
| InChIKey | UYLICFCSAFGTFJ-IBGZPJMESA-N |
| XLogP | 4.07 |
| TPSA | 159.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|