C31H27NO8 — CID 99987621
8-[(1S)-1-(2H-chromen-3-yl)-3-morpholin-4-yl-3-oxopropyl]-5,6,7-trihydroxy-2-phenylchromen-4-one (PubChem CID 99987621) has the molecular formula C31H27NO8 and a molecular weight of 541.56 g/mol. Its IUPAC name is 8-[(1S)-1-(2H-chromen-3-yl)-3-morpholin-4-yl-3-oxopropyl]-5,6,7-trihydroxy-2-phenylchromen-4-one.
| Compound Name | 8-[(1S)-1-(2H-chromen-3-yl)-3-morpholin-4-yl-3-oxopropyl]-5,6,7-trihydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 99987621 |
| Molecular Formula | C31H27NO8 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 8-[(1S)-1-(2H-chromen-3-yl)-3-morpholin-4-yl-3-oxopropyl]-5,6,7-trihydroxy-2-phenylchromen-4-one |
| SMILES | O=C(C[C@@H](C1=Cc2ccccc2OC1)c1c(O)c(O)c(O)c2c(=O)cc(-c3ccccc3)oc12)N1CCOCC1 |
| InChI | InChI=1S/C31H27NO8/c33-22-16-24(18-6-2-1-3-7-18)40-31-26(28(35)30(37)29(36)27(22)31)21(15-25(34)32-10-12-38-13-11-32)20-14-19-8-4-5-9-23(19)39-17-20/h1-9,14,16,21,35-37H,10-13,15,17H2/t21-/m0/s1 |
| InChIKey | BEKMYAZJJVWGMA-NRFANRHFSA-N |
| XLogP | 4.39 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|