C31H24O10 — CID 98885075
methyl 4-[5-[(1S)-3-methoxy-3-oxo-1-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propyl]furan-2-yl]benzoate (PubChem CID 98885075) has the molecular formula C31H24O10 and a molecular weight of 556.52 g/mol. Its IUPAC name is methyl 4-[5-[(1S)-3-methoxy-3-oxo-1-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[(1S)-3-methoxy-3-oxo-1-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 98885075 |
| Molecular Formula | C31H24O10 |
| Molecular Weight | 556.52 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | methyl 4-[5-[(1S)-3-methoxy-3-oxo-1-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propyl]furan-2-yl]benzoate |
| SMILES | COC(=O)C[C@H](c1ccc(-c2ccc(C(=O)OC)cc2)o1)c1c(O)c(O)c(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C31H24O10/c1-38-24(33)14-19(22-13-12-21(40-22)17-8-10-18(11-9-17)31(37)39-2)25-27(34)29(36)28(35)26-20(32)15-23(41-30(25)26)16-6-4-3-5-7-16/h3-13,15,19,34-36H,14H2,1-2H3/t19-/m1/s1 |
| InChIKey | OMTYAVMNZCQKEU-LJQANCHMSA-N |
| XLogP | 5.32 |
| TPSA | 156.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|