C28H25NO8 — CID 99983743
5,6,7-trihydroxy-8-[(1R)-1-(4-hydroxyphenyl)-3-morpholin-4-yl-3-oxopropyl]-2-phenylchromen-4-one (PubChem CID 99983743) has the molecular formula C28H25NO8 and a molecular weight of 503.51 g/mol. Its IUPAC name is 5,6,7-trihydroxy-8-[(1R)-1-(4-hydroxyphenyl)-3-morpholin-4-yl-3-oxopropyl]-2-phenylchromen-4-one.
| Compound Name | 5,6,7-trihydroxy-8-[(1R)-1-(4-hydroxyphenyl)-3-morpholin-4-yl-3-oxopropyl]-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 99983743 |
| Molecular Formula | C28H25NO8 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 5,6,7-trihydroxy-8-[(1R)-1-(4-hydroxyphenyl)-3-morpholin-4-yl-3-oxopropyl]-2-phenylchromen-4-one |
| SMILES | O=C(C[C@H](c1ccc(O)cc1)c1c(O)c(O)c(O)c2c(=O)cc(-c3ccccc3)oc12)N1CCOCC1 |
| InChI | InChI=1S/C28H25NO8/c30-18-8-6-16(7-9-18)19(14-22(32)29-10-12-36-13-11-29)23-25(33)27(35)26(34)24-20(31)15-21(37-28(23)24)17-4-2-1-3-5-17/h1-9,15,19,30,33-35H,10-14H2/t19-/m1/s1 |
| InChIKey | MFVXJGQZCOQGHR-LJQANCHMSA-N |
| XLogP | 3.66 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|