C30H29NO9 — CID 99992509
8-[(1R)-1-(3,4-dimethoxyphenyl)-3-morpholin-4-yl-3-oxopropyl]-5,6,7-trihydroxy-2-phenylchromen-4-one (PubChem CID 99992509) has the molecular formula C30H29NO9 and a molecular weight of 547.56 g/mol. Its IUPAC name is 8-[(1R)-1-(3,4-dimethoxyphenyl)-3-morpholin-4-yl-3-oxopropyl]-5,6,7-trihydroxy-2-phenylchromen-4-one.
| Compound Name | 8-[(1R)-1-(3,4-dimethoxyphenyl)-3-morpholin-4-yl-3-oxopropyl]-5,6,7-trihydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 99992509 |
| Molecular Formula | C30H29NO9 |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 8-[(1R)-1-(3,4-dimethoxyphenyl)-3-morpholin-4-yl-3-oxopropyl]-5,6,7-trihydroxy-2-phenylchromen-4-one |
| SMILES | COc1ccc([C@@H](CC(=O)N2CCOCC2)c2c(O)c(O)c(O)c3c(=O)cc(-c4ccccc4)oc23)cc1OC |
| InChI | InChI=1S/C30H29NO9/c1-37-21-9-8-18(14-23(21)38-2)19(15-24(33)31-10-12-39-13-11-31)25-27(34)29(36)28(35)26-20(32)16-22(40-30(25)26)17-6-4-3-5-7-17/h3-9,14,16,19,34-36H,10-13,15H2,1-2H3/t19-/m1/s1 |
| InChIKey | DGGHZVYONZOBJD-LJQANCHMSA-N |
| XLogP | 3.97 |
| TPSA | 138.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|