C28H25NO6 — CID 71827102
5,7-dihydroxy-8-(3-morpholin-4-yl-3-oxo-1-phenylpropyl)-2-phenylchromen-4-one (PubChem CID 71827102) has the molecular formula C28H25NO6 and a molecular weight of 471.51 g/mol. Its IUPAC name is 5,7-dihydroxy-8-(3-morpholin-4-yl-3-oxo-1-phenylpropyl)-2-phenylchromen-4-one.
| Compound Name | 5,7-dihydroxy-8-(3-morpholin-4-yl-3-oxo-1-phenylpropyl)-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 71827102 |
| Molecular Formula | C28H25NO6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 5,7-dihydroxy-8-(3-morpholin-4-yl-3-oxo-1-phenylpropyl)-2-phenylchromen-4-one |
| SMILES | O=C(CC(c1ccccc1)c1c(O)cc(O)c2c(=O)cc(-c3ccccc3)oc12)N1CCOCC1 |
| InChI | InChI=1S/C28H25NO6/c30-21-16-22(31)27-23(32)17-24(19-9-5-2-6-10-19)35-28(27)26(21)20(18-7-3-1-4-8-18)15-25(33)29-11-13-34-14-12-29/h1-10,16-17,20,30-31H,11-15H2 |
| InChIKey | HKINTJMYLSJRRE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |