C14H14O5 — CID 71681617
methyl (3R)-3-(4-hydroxy-2-oxochromen-3-yl)butanoate (PubChem CID 71681617) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is methyl (3R)-3-(4-hydroxy-2-oxochromen-3-yl)butanoate.
| Compound Name | methyl (3R)-3-(4-hydroxy-2-oxochromen-3-yl)butanoate |
|---|---|
| PubChem CID | 71681617 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | methyl (3R)-3-(4-hydroxy-2-oxochromen-3-yl)butanoate |
| SMILES | COC(=O)C[C@@H](C)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C14H14O5/c1-8(7-11(15)18-2)12-13(16)9-5-3-4-6-10(9)19-14(12)17/h3-6,8,16H,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | ULJJXUMVXKYDBK-MRVPVSSYSA-N |
| XLogP | 2.17 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|