C28H26O7 — CID 99992519
methyl (3S)-3-(4-hydroxy-2-oxochromen-3-yl)-3-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]propanoate (PubChem CID 99992519) has the molecular formula C28H26O7 and a molecular weight of 474.51 g/mol. Its IUPAC name is methyl (3S)-3-(4-hydroxy-2-oxochromen-3-yl)-3-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]propanoate.
| Compound Name | methyl (3S)-3-(4-hydroxy-2-oxochromen-3-yl)-3-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 99992519 |
| Molecular Formula | C28H26O7 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | methyl (3S)-3-(4-hydroxy-2-oxochromen-3-yl)-3-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C[C@@H](c1ccccc1OCCc1ccc(OC)cc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C28H26O7/c1-32-19-13-11-18(12-14-19)15-16-34-23-9-5-3-7-20(23)22(17-25(29)33-2)26-27(30)21-8-4-6-10-24(21)35-28(26)31/h3-14,22,30H,15-17H2,1-2H3/t22-/m0/s1 |
| InChIKey | QFNFCHZRSPCNCP-QFIPXVFZSA-N |
| XLogP | 4.82 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|