C22H16O5 — CID 87271574
3-(4-hydroxy-2-oxochromen-3-yl)-3-naphthalen-1-ylpropanoic acid (PubChem CID 87271574) has the molecular formula C22H16O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is 3-(4-hydroxy-2-oxochromen-3-yl)-3-naphthalen-1-ylpropanoic acid.
| Compound Name | 3-(4-hydroxy-2-oxochromen-3-yl)-3-naphthalen-1-ylpropanoic acid |
|---|---|
| PubChem CID | 87271574 |
| Molecular Formula | C22H16O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 3-(4-hydroxy-2-oxochromen-3-yl)-3-naphthalen-1-ylpropanoic acid |
| SMILES | O=C(O)CC(c1c(O)c2ccccc2oc1=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H16O5/c23-19(24)12-17(15-10-5-7-13-6-1-2-8-14(13)15)20-21(25)16-9-3-4-11-18(16)27-22(20)26/h1-11,17,25H,12H2,(H,23,24) |
| InChIKey | ULPFDUXNYSRMTP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|