C25H14Cl2O6 — CID 171352988
3-[(2,6-dichlorophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one (PubChem CID 171352988) has the molecular formula C25H14Cl2O6 and a molecular weight of 481.29 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[(2,6-dichlorophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 171352988 |
| Molecular Formula | C25H14Cl2O6 |
| Molecular Weight | 481.29 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1C(c1c(Cl)cccc1Cl)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C25H14Cl2O6/c26-14-8-5-9-15(27)18(14)19(20-22(28)12-6-1-3-10-16(12)32-24(20)30)21-23(29)13-7-2-4-11-17(13)33-25(21)31/h1-11,19,28-29H |
| InChIKey | QZGSCNOGFYSERW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.29 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|