C24H16ClNO3 — CID 102490093
3-[(4-chlorophenyl)-(1H-indol-3-yl)methyl]-4-hydroxychromen-2-one (PubChem CID 102490093) has the molecular formula C24H16ClNO3 and a molecular weight of 401.85 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)-(1H-indol-3-yl)methyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[(4-chlorophenyl)-(1H-indol-3-yl)methyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 102490093 |
| Molecular Formula | C24H16ClNO3 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 3-[(4-chlorophenyl)-(1H-indol-3-yl)methyl]-4-hydroxychromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1C(c1ccc(Cl)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H16ClNO3/c25-15-11-9-14(10-12-15)21(18-13-26-19-7-3-1-5-16(18)19)22-23(27)17-6-2-4-8-20(17)29-24(22)28/h1-13,21,26-27H |
| InChIKey | QUROBKULSCWEFC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|