C21H16ClNO4 — CID 118711656
2-[(4-chlorophenyl)-(1H-indol-3-yl)methyl]-3-hydroxy-6-(hydroxymethyl)pyran-4-one (PubChem CID 118711656) has the molecular formula C21H16ClNO4 and a molecular weight of 381.82 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)-(1H-indol-3-yl)methyl]-3-hydroxy-6-(hydroxymethyl)pyran-4-one.
| Compound Name | 2-[(4-chlorophenyl)-(1H-indol-3-yl)methyl]-3-hydroxy-6-(hydroxymethyl)pyran-4-one |
|---|---|
| PubChem CID | 118711656 |
| Molecular Formula | C21H16ClNO4 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-[(4-chlorophenyl)-(1H-indol-3-yl)methyl]-3-hydroxy-6-(hydroxymethyl)pyran-4-one |
| SMILES | O=c1cc(CO)oc(C(c2ccc(Cl)cc2)c2c[nH]c3ccccc23)c1O |
| InChI | InChI=1S/C21H16ClNO4/c22-13-7-5-12(6-8-13)19(16-10-23-17-4-2-1-3-15(16)17)21-20(26)18(25)9-14(11-24)27-21/h1-10,19,23-24,26H,11H2 |
| InChIKey | PKMBVHGXICDRRD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |