C24H17ClN2O — CID 18807557
1-(4-chlorophenyl)-2,2-bis(1H-indol-3-yl)ethanone (PubChem CID 18807557) has the molecular formula C24H17ClN2O and a molecular weight of 384.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2-bis(1H-indol-3-yl)ethanone.
| Compound Name | 1-(4-chlorophenyl)-2,2-bis(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 18807557 |
| Molecular Formula | C24H17ClN2O |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2-bis(1H-indol-3-yl)ethanone |
| SMILES | O=C(c1ccc(Cl)cc1)C(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H17ClN2O/c25-16-11-9-15(10-12-16)24(28)23(19-13-26-21-7-3-1-5-17(19)21)20-14-27-22-8-4-2-6-18(20)22/h1-14,23,26-27H |
| InChIKey | ZFWUOWZRVUAANX-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |