C24H18BrN3O — CID 85469647
(NZ)-N-[1-(4-bromophenyl)-2,2-bis(1H-indol-3-yl)ethylidene]hydroxylamine (PubChem CID 85469647) has the molecular formula C24H18BrN3O and a molecular weight of 444.33 g/mol. Its IUPAC name is (NZ)-N-[1-(4-bromophenyl)-2,2-bis(1H-indol-3-yl)ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(4-bromophenyl)-2,2-bis(1H-indol-3-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 85469647 |
| Molecular Formula | C24H18BrN3O |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | (NZ)-N-[1-(4-bromophenyl)-2,2-bis(1H-indol-3-yl)ethylidene]hydroxylamine |
| SMILES | O/N=C(\c1ccc(Br)cc1)C(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H18BrN3O/c25-16-11-9-15(10-12-16)24(28-29)23(19-13-26-21-7-3-1-5-17(19)21)20-14-27-22-8-4-2-6-18(20)22/h1-14,23,26-27,29H/b28-24+ |
| InChIKey | ZOFSXVMZDDWJNA-ZZIIXHQDSA-N |
| XLogP | 6.42 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|