C19H21NO4 — CID 146510917
3-hydroxy-6-(hydroxymethyl)-2-[1-(1H-indol-3-yl)-3-methylbutyl]pyran-4-one (PubChem CID 146510917) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-hydroxy-6-(hydroxymethyl)-2-[1-(1H-indol-3-yl)-3-methylbutyl]pyran-4-one.
| Compound Name | 3-hydroxy-6-(hydroxymethyl)-2-[1-(1H-indol-3-yl)-3-methylbutyl]pyran-4-one |
|---|---|
| PubChem CID | 146510917 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 3-hydroxy-6-(hydroxymethyl)-2-[1-(1H-indol-3-yl)-3-methylbutyl]pyran-4-one |
| SMILES | CC(C)CC(c1oc(CO)cc(=O)c1O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H21NO4/c1-11(2)7-14(15-9-20-16-6-4-3-5-13(15)16)19-18(23)17(22)8-12(10-21)24-19/h3-6,8-9,11,14,20-21,23H,7,10H2,1-2H3 |
| InChIKey | GBYSQYQXMJZDJX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |