C21H20O5 — CID 87781345
propyl 3-(4-hydroxy-2-oxochromen-3-yl)-3-phenylpropanoate (PubChem CID 87781345) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is propyl 3-(4-hydroxy-2-oxochromen-3-yl)-3-phenylpropanoate.
| Compound Name | propyl 3-(4-hydroxy-2-oxochromen-3-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 87781345 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | propyl 3-(4-hydroxy-2-oxochromen-3-yl)-3-phenylpropanoate |
| SMILES | CCCOC(=O)CC(c1ccccc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C21H20O5/c1-2-12-25-18(22)13-16(14-8-4-3-5-9-14)19-20(23)15-10-6-7-11-17(15)26-21(19)24/h3-11,16,23H,2,12-13H2,1H3 |
| InChIKey | HDPPEVGLHOZUGM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|