C27H22N2O6 — CID 132563812
4-[(4-hydroxy-3-methoxyphenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one (PubChem CID 132563812) has the molecular formula C27H22N2O6 and a molecular weight of 470.48 g/mol. Its IUPAC name is 4-[(4-hydroxy-3-methoxyphenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-[(4-hydroxy-3-methoxyphenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 132563812 |
| Molecular Formula | C27H22N2O6 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 4-[(4-hydroxy-3-methoxyphenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
| SMILES | COc1cc(C(c2c(O)c3ccccc3oc2=O)c2c(C)[nH]n(-c3ccccc3)c2=O)ccc1O |
| InChI | InChI=1S/C27H22N2O6/c1-15-22(26(32)29(28-15)17-8-4-3-5-9-17)23(16-12-13-19(30)21(14-16)34-2)24-25(31)18-10-6-7-11-20(18)35-27(24)33/h3-14,23,28,30-31H,1-2H3 |
| InChIKey | ZTDXLQKZVJANMN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|