C32H34N4O4 — CID 139229969
4-[[4-(diethoxymethyl)phenyl]-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one (PubChem CID 139229969) has the molecular formula C32H34N4O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is 4-[[4-(diethoxymethyl)phenyl]-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-[[4-(diethoxymethyl)phenyl]-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 139229969 |
| Molecular Formula | C32H34N4O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 4-[[4-(diethoxymethyl)phenyl]-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
| SMILES | CCOC(OCC)c1ccc(C(c2c(C)[nH]n(-c3ccccc3)c2=O)c2c(C)[nH]n(-c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C32H34N4O4/c1-5-39-32(40-6-2)24-19-17-23(18-20-24)29(27-21(3)33-35(30(27)37)25-13-9-7-10-14-25)28-22(4)34-36(31(28)38)26-15-11-8-12-16-26/h7-20,29,32-34H,5-6H2,1-4H3 |
| InChIKey | URIBBGAJQJEHLV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|