C27H23IN4O2 — CID 50884104
4-[(3-iodophenyl)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one (PubChem CID 50884104) has the molecular formula C27H23IN4O2 and a molecular weight of 562.41 g/mol. Its IUPAC name is 4-[(3-iodophenyl)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-[(3-iodophenyl)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 50884104 |
| Molecular Formula | C27H23IN4O2 |
| Molecular Weight | 562.41 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | 4-[(3-iodophenyl)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1C(c1cccc(I)c1)c1c(C)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C27H23IN4O2/c1-17-23(26(33)31(29-17)21-12-5-3-6-13-21)25(19-10-9-11-20(28)16-19)24-18(2)30-32(27(24)34)22-14-7-4-8-15-22/h3-16,25,29-30H,1-2H3 |
| InChIKey | KWBLUIMJHFVNIN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 75.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|