C29H28N6O4 — CID 50885626
4-[[4-(dimethylamino)-3-nitrophenyl]-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one (PubChem CID 50885626) has the molecular formula C29H28N6O4 and a molecular weight of 524.58 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)-3-nitrophenyl]-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-[[4-(dimethylamino)-3-nitrophenyl]-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 50885626 |
| Molecular Formula | C29H28N6O4 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 4-[[4-(dimethylamino)-3-nitrophenyl]-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1C(c1ccc(N(C)C)c([N+](=O)[O-])c1)c1c(C)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C29H28N6O4/c1-18-25(28(36)33(30-18)21-11-7-5-8-12-21)27(20-15-16-23(32(3)4)24(17-20)35(38)39)26-19(2)31-34(29(26)37)22-13-9-6-10-14-22/h5-17,27,30-31H,1-4H3 |
| InChIKey | GFDIBWHINUHJSD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|