C18H16N4O5 — CID 71814704
5-methyl-4-[(1R)-2-nitro-1-(3-nitrophenyl)ethyl]-2-phenyl-1H-pyrazol-3-one (PubChem CID 71814704) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is 5-methyl-4-[(1R)-2-nitro-1-(3-nitrophenyl)ethyl]-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 5-methyl-4-[(1R)-2-nitro-1-(3-nitrophenyl)ethyl]-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 71814704 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 5-methyl-4-[(1R)-2-nitro-1-(3-nitrophenyl)ethyl]-2-phenyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1[C@H](C[N+](=O)[O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N4O5/c1-12-17(18(23)21(19-12)14-7-3-2-4-8-14)16(11-20(24)25)13-6-5-9-15(10-13)22(26)27/h2-10,16,19H,11H2,1H3/t16-/m1/s1 |
| InChIKey | NGXXYLLNYOCFNV-MRXNPFEDSA-N |
| XLogP | 2.79 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|