C27H20N4O6 — CID 132966716
4-[(2,4-dinitrophenyl)-(2-hydroxynaphthalen-1-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one (PubChem CID 132966716) has the molecular formula C27H20N4O6 and a molecular weight of 496.48 g/mol. Its IUPAC name is 4-[(2,4-dinitrophenyl)-(2-hydroxynaphthalen-1-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-[(2,4-dinitrophenyl)-(2-hydroxynaphthalen-1-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 132966716 |
| Molecular Formula | C27H20N4O6 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 4-[(2,4-dinitrophenyl)-(2-hydroxynaphthalen-1-yl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1C(c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C27H20N4O6/c1-16-24(27(33)29(28-16)18-8-3-2-4-9-18)26(21-13-12-19(30(34)35)15-22(21)31(36)37)25-20-10-6-5-7-17(20)11-14-23(25)32/h2-15,26,28,32H,1H3 |
| InChIKey | FWHFPOIESROOOC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 144.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|