C33H26N2O2 — CID 177414285
4-[(2-hydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one (PubChem CID 177414285) has the molecular formula C33H26N2O2 and a molecular weight of 482.58 g/mol. Its IUPAC name is 4-[(2-hydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-[(2-hydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 177414285 |
| Molecular Formula | C33H26N2O2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 4-[(2-hydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1C(c1ccc(-c2ccccc2)cc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C33H26N2O2/c1-22-30(33(37)35(34-22)27-13-6-3-7-14-27)31(32-28-15-9-8-12-25(28)20-21-29(32)36)26-18-16-24(17-19-26)23-10-4-2-5-11-23/h2-21,31,34,36H,1H3 |
| InChIKey | OMJYDNMHNNUNEE-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |