C28H22N2O5 — CID 132837476
4-hydroxy-3-[(4-methoxyphenyl)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]naphthalene-1,2-dione (PubChem CID 132837476) has the molecular formula C28H22N2O5 and a molecular weight of 466.49 g/mol. Its IUPAC name is 4-hydroxy-3-[(4-methoxyphenyl)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]naphthalene-1,2-dione.
| Compound Name | 4-hydroxy-3-[(4-methoxyphenyl)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]naphthalene-1,2-dione |
|---|---|
| PubChem CID | 132837476 |
| Molecular Formula | C28H22N2O5 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 4-hydroxy-3-[(4-methoxyphenyl)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]naphthalene-1,2-dione |
| SMILES | COc1ccc(C(C2=C(O)c3ccccc3C(=O)C2=O)c2c(C)[nH]n(-c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C28H22N2O5/c1-16-22(28(34)30(29-16)18-8-4-3-5-9-18)23(17-12-14-19(35-2)15-13-17)24-25(31)20-10-6-7-11-21(20)26(32)27(24)33/h3-15,23,29,31H,1-2H3 |
| InChIKey | XXSROLXQOPUTAZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|