C35H29FN4O5 — CID 4559759
[4-[bis(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-2-methoxyphenyl] 2-fluorobenzoate (PubChem CID 4559759) has the molecular formula C35H29FN4O5 and a molecular weight of 604.64 g/mol. Its IUPAC name is [4-[bis(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-2-methoxyphenyl] 2-fluorobenzoate.
| Compound Name | [4-[bis(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-2-methoxyphenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 4559759 |
| Molecular Formula | C35H29FN4O5 |
| Molecular Weight | 604.64 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | [4-[bis(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]-2-methoxyphenyl] 2-fluorobenzoate |
| SMILES | COc1cc(C(c2c(C)[nH]n(-c3ccccc3)c2=O)c2c(C)[nH]n(-c3ccccc3)c2=O)ccc1OC(=O)c1ccccc1F |
| InChI | InChI=1S/C35H29FN4O5/c1-21-30(33(41)39(37-21)24-12-6-4-7-13-24)32(31-22(2)38-40(34(31)42)25-14-8-5-9-15-25)23-18-19-28(29(20-23)44-3)45-35(43)26-16-10-11-17-27(26)36/h4-20,32,37-38H,1-3H3 |
| InChIKey | GDVDESVSKLYEEY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|