C25H21BrO3 — CID 56998907
3-[1-[4-(4-bromophenyl)phenyl]butyl]-4-hydroxychromen-2-one (PubChem CID 56998907) has the molecular formula C25H21BrO3 and a molecular weight of 449.34 g/mol. Its IUPAC name is 3-[1-[4-(4-bromophenyl)phenyl]butyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[1-[4-(4-bromophenyl)phenyl]butyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 56998907 |
| Molecular Formula | C25H21BrO3 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 3-[1-[4-(4-bromophenyl)phenyl]butyl]-4-hydroxychromen-2-one |
| SMILES | CCCC(c1ccc(-c2ccc(Br)cc2)cc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C25H21BrO3/c1-2-5-20(23-24(27)21-6-3-4-7-22(21)29-25(23)28)18-10-8-16(9-11-18)17-12-14-19(26)15-13-17/h3-4,6-15,20,27H,2,5H2,1H3 |
| InChIKey | XNMBYKJFKHCKAN-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|