C21H18N2O8 — CID 90195954
2-[(E)-[4-(4-hydroxy-2-oxochromen-3-yl)-4-(4-nitrophenyl)butan-2-ylidene]amino]oxyacetic acid (PubChem CID 90195954) has the molecular formula C21H18N2O8 and a molecular weight of 426.38 g/mol. Its IUPAC name is 2-[(E)-[4-(4-hydroxy-2-oxochromen-3-yl)-4-(4-nitrophenyl)butan-2-ylidene]amino]oxyacetic acid.
| Compound Name | 2-[(E)-[4-(4-hydroxy-2-oxochromen-3-yl)-4-(4-nitrophenyl)butan-2-ylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 90195954 |
| Molecular Formula | C21H18N2O8 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-[(E)-[4-(4-hydroxy-2-oxochromen-3-yl)-4-(4-nitrophenyl)butan-2-ylidene]amino]oxyacetic acid |
| SMILES | C/C(CC(c1ccc([N+](=O)[O-])cc1)c1c(O)c2ccccc2oc1=O)=N\OCC(=O)O |
| InChI | InChI=1S/C21H18N2O8/c1-12(22-30-11-18(24)25)10-16(13-6-8-14(9-7-13)23(28)29)19-20(26)15-4-2-3-5-17(15)31-21(19)27/h2-9,16,26H,10-11H2,1H3,(H,24,25)/b22-12+ |
| InChIKey | XRYSHYQUWYVCTB-WSDLNYQXSA-N |
| XLogP | 3.41 |
| TPSA | 152.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|