C19H15FO4 — CID 54690017
7-fluoro-4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one (PubChem CID 54690017) has the molecular formula C19H15FO4 and a molecular weight of 326.32 g/mol. Its IUPAC name is 7-fluoro-4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one.
| Compound Name | 7-fluoro-4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one |
|---|---|
| PubChem CID | 54690017 |
| Molecular Formula | C19H15FO4 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 7-fluoro-4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one |
| SMILES | CC(=O)CC(c1ccccc1)c1c(O)c2ccc(F)cc2oc1=O |
| InChI | InChI=1S/C19H15FO4/c1-11(21)9-15(12-5-3-2-4-6-12)17-18(22)14-8-7-13(20)10-16(14)24-19(17)23/h2-8,10,15,22H,9H2,1H3 |
| InChIKey | VHWWUPZLRFLYBX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|