C44H26O16 — CID 54738681
3-[[3-[bis(4,7-dihydroxy-2-oxochromen-3-yl)methyl]phenyl]-(4,7-dihydroxy-2-oxochromen-3-yl)methyl]-4,7-dihydroxychromen-2-one (PubChem CID 54738681) has the molecular formula C44H26O16 and a molecular weight of 810.68 g/mol. Its IUPAC name is 3-[[3-[bis(4,7-dihydroxy-2-oxochromen-3-yl)methyl]phenyl]-(4,7-dihydroxy-2-oxochromen-3-yl)methyl]-4,7-dihydroxychromen-2-one.
| Compound Name | 3-[[3-[bis(4,7-dihydroxy-2-oxochromen-3-yl)methyl]phenyl]-(4,7-dihydroxy-2-oxochromen-3-yl)methyl]-4,7-dihydroxychromen-2-one |
|---|---|
| PubChem CID | 54738681 |
| Molecular Formula | C44H26O16 |
| Molecular Weight | 810.68 g/mol |
| Exact Mass | 810.12 |
| IUPAC Name | 3-[[3-[bis(4,7-dihydroxy-2-oxochromen-3-yl)methyl]phenyl]-(4,7-dihydroxy-2-oxochromen-3-yl)methyl]-4,7-dihydroxychromen-2-one |
| SMILES | O=c1oc2cc(O)ccc2c(O)c1C(c1cccc(C(c2c(O)c3ccc(O)cc3oc2=O)c2c(O)c3ccc(O)cc3oc2=O)c1)c1c(O)c2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C44H26O16/c45-19-4-8-23-27(13-19)57-41(53)33(37(23)49)31(34-38(50)24-9-5-20(46)14-28(24)58-42(34)54)17-2-1-3-18(12-17)32(35-39(51)25-10-6-21(47)15-29(25)59-43(35)55)36-40(52)26-11-7-22(48)16-30(26)60-44(36)56/h1-16,31-32,45-52H |
| InChIKey | MQZVROWYVOEIHB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 282.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|