C10H6O5 — CID 137208579
4,7-dihydroxy-2-oxochromene-3-carbaldehyde (PubChem CID 137208579) has the molecular formula C10H6O5 and a molecular weight of 206.15 g/mol. Its IUPAC name is 4,7-dihydroxy-2-oxochromene-3-carbaldehyde.
| Compound Name | 4,7-dihydroxy-2-oxochromene-3-carbaldehyde |
|---|---|
| PubChem CID | 137208579 |
| Molecular Formula | C10H6O5 |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 4,7-dihydroxy-2-oxochromene-3-carbaldehyde |
| SMILES | O=Cc1c(O)c2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C10H6O5/c11-4-7-9(13)6-2-1-5(12)3-8(6)15-10(7)14/h1-4,12-13H |
| InChIKey | FFUVABGINNSZDM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|