C11H8O6 — CID 54735281
(4,7-dihydroxy-2-oxochromen-3-yl) acetate (PubChem CID 54735281) has the molecular formula C11H8O6 and a molecular weight of 236.18 g/mol. Its IUPAC name is (4,7-dihydroxy-2-oxochromen-3-yl) acetate.
| Compound Name | (4,7-dihydroxy-2-oxochromen-3-yl) acetate |
|---|---|
| PubChem CID | 54735281 |
| Molecular Formula | C11H8O6 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | (4,7-dihydroxy-2-oxochromen-3-yl) acetate |
| SMILES | CC(=O)Oc1c(O)c2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C11H8O6/c1-5(12)16-10-9(14)7-3-2-6(13)4-8(7)17-11(10)15/h2-4,13-14H,1H3 |
| InChIKey | ZDOARIKZCRNDNT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|