C31H18Br2O7 — CID 59746743
6-bromo-3-[(6-bromo-4-hydroxy-2-oxochromen-3-yl)-(3-phenoxyphenyl)methyl]-4-hydroxychromen-2-one (PubChem CID 59746743) has the molecular formula C31H18Br2O7 and a molecular weight of 662.29 g/mol. Its IUPAC name is 6-bromo-3-[(6-bromo-4-hydroxy-2-oxochromen-3-yl)-(3-phenoxyphenyl)methyl]-4-hydroxychromen-2-one.
| Compound Name | 6-bromo-3-[(6-bromo-4-hydroxy-2-oxochromen-3-yl)-(3-phenoxyphenyl)methyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 59746743 |
| Molecular Formula | C31H18Br2O7 |
| Molecular Weight | 662.29 g/mol |
| Exact Mass | 659.94 |
| IUPAC Name | 6-bromo-3-[(6-bromo-4-hydroxy-2-oxochromen-3-yl)-(3-phenoxyphenyl)methyl]-4-hydroxychromen-2-one |
| SMILES | O=c1oc2ccc(Br)cc2c(O)c1C(c1cccc(Oc2ccccc2)c1)c1c(O)c2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C31H18Br2O7/c32-17-9-11-23-21(14-17)28(34)26(30(36)39-23)25(16-5-4-8-20(13-16)38-19-6-2-1-3-7-19)27-29(35)22-15-18(33)10-12-24(22)40-31(27)37/h1-15,25,34-35H |
| InChIKey | MPXHISQPESBVBF-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.29 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|