C27H17BrF2O5 — CID 143310034
3-[(3-bromo-4-methylphenyl)-(6-fluoro-4-hydroxy-2-oxochromen-3-yl)methyl]-6-fluoro-4-methylchromen-2-one (PubChem CID 143310034) has the molecular formula C27H17BrF2O5 and a molecular weight of 539.33 g/mol. Its IUPAC name is 3-[(3-bromo-4-methylphenyl)-(6-fluoro-4-hydroxy-2-oxochromen-3-yl)methyl]-6-fluoro-4-methylchromen-2-one.
| Compound Name | 3-[(3-bromo-4-methylphenyl)-(6-fluoro-4-hydroxy-2-oxochromen-3-yl)methyl]-6-fluoro-4-methylchromen-2-one |
|---|---|
| PubChem CID | 143310034 |
| Molecular Formula | C27H17BrF2O5 |
| Molecular Weight | 539.33 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | 3-[(3-bromo-4-methylphenyl)-(6-fluoro-4-hydroxy-2-oxochromen-3-yl)methyl]-6-fluoro-4-methylchromen-2-one |
| SMILES | Cc1ccc(C(c2c(C)c3cc(F)ccc3oc2=O)c2c(O)c3cc(F)ccc3oc2=O)cc1Br |
| InChI | InChI=1S/C27H17BrF2O5/c1-12-3-4-14(9-19(12)28)23(22-13(2)17-10-15(29)5-7-20(17)34-26(22)32)24-25(31)18-11-16(30)6-8-21(18)35-27(24)33/h3-11,23,31H,1-2H3 |
| InChIKey | YUDKZGHTKPFPEX-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.33 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|