C34H34O6 — CID 143310064
6-ethyl-3-[(6-ethyl-4-hydroxy-2-oxochromen-3-yl)-(4-methyl-3-propoxyphenyl)methyl]-4-methylchromen-2-one (PubChem CID 143310064) has the molecular formula C34H34O6 and a molecular weight of 538.64 g/mol. Its IUPAC name is 6-ethyl-3-[(6-ethyl-4-hydroxy-2-oxochromen-3-yl)-(4-methyl-3-propoxyphenyl)methyl]-4-methylchromen-2-one.
| Compound Name | 6-ethyl-3-[(6-ethyl-4-hydroxy-2-oxochromen-3-yl)-(4-methyl-3-propoxyphenyl)methyl]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 143310064 |
| Molecular Formula | C34H34O6 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 6-ethyl-3-[(6-ethyl-4-hydroxy-2-oxochromen-3-yl)-(4-methyl-3-propoxyphenyl)methyl]-4-methylchromen-2-one |
| SMILES | CCCOc1cc(C(c2c(C)c3cc(CC)ccc3oc2=O)c2c(O)c3cc(CC)ccc3oc2=O)ccc1C |
| InChI | InChI=1S/C34H34O6/c1-6-15-38-28-18-23(12-9-19(28)4)30(29-20(5)24-16-21(7-2)10-13-26(24)39-33(29)36)31-32(35)25-17-22(8-3)11-14-27(25)40-34(31)37/h9-14,16-18,30,35H,6-8,15H2,1-5H3 |
| InChIKey | UIPYUVZLEMXNIM-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|