C29H17Cl2NO5 — CID 143309916
6-chloro-3-[(6-chloro-4-hydroxy-2-oxochromen-3-yl)-quinolin-4-ylmethyl]-4-methylchromen-2-one (PubChem CID 143309916) has the molecular formula C29H17Cl2NO5 and a molecular weight of 530.36 g/mol. Its IUPAC name is 6-chloro-3-[(6-chloro-4-hydroxy-2-oxochromen-3-yl)-quinolin-4-ylmethyl]-4-methylchromen-2-one.
| Compound Name | 6-chloro-3-[(6-chloro-4-hydroxy-2-oxochromen-3-yl)-quinolin-4-ylmethyl]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 143309916 |
| Molecular Formula | C29H17Cl2NO5 |
| Molecular Weight | 530.36 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | 6-chloro-3-[(6-chloro-4-hydroxy-2-oxochromen-3-yl)-quinolin-4-ylmethyl]-4-methylchromen-2-one |
| SMILES | Cc1c(C(c2c(O)c3cc(Cl)ccc3oc2=O)c2ccnc3ccccc23)c(=O)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C29H17Cl2NO5/c1-14-19-12-15(30)6-8-22(19)36-28(34)24(14)25(18-10-11-32-21-5-3-2-4-17(18)21)26-27(33)20-13-16(31)7-9-23(20)37-29(26)35/h2-13,25,33H,1H3 |
| InChIKey | VRULXRKDRHBPIE-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.36 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|