C21H12Cl2O8 — CID 54678009
methyl 2,2-bis(6-chloro-4-hydroxy-2-oxochromen-3-yl)acetate (PubChem CID 54678009) has the molecular formula C21H12Cl2O8 and a molecular weight of 463.23 g/mol. Its IUPAC name is methyl 2,2-bis(6-chloro-4-hydroxy-2-oxochromen-3-yl)acetate.
| Compound Name | methyl 2,2-bis(6-chloro-4-hydroxy-2-oxochromen-3-yl)acetate |
|---|---|
| PubChem CID | 54678009 |
| Molecular Formula | C21H12Cl2O8 |
| Molecular Weight | 463.23 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | methyl 2,2-bis(6-chloro-4-hydroxy-2-oxochromen-3-yl)acetate |
| SMILES | COC(=O)C(c1c(O)c2cc(Cl)ccc2oc1=O)c1c(O)c2cc(Cl)ccc2oc1=O |
| InChI | InChI=1S/C21H12Cl2O8/c1-29-19(26)14(15-17(24)10-6-8(22)2-4-12(10)30-20(15)27)16-18(25)11-7-9(23)3-5-13(11)31-21(16)28/h2-7,14,24-25H,1H3 |
| InChIKey | LFAIPHCCKMYAHY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|