C24H20O9 — CID 59746837
2-hydroxyethyl 2,2-bis(4-hydroxy-6-methyl-2-oxochromen-3-yl)acetate (PubChem CID 59746837) has the molecular formula C24H20O9 and a molecular weight of 452.42 g/mol. Its IUPAC name is 2-hydroxyethyl 2,2-bis(4-hydroxy-6-methyl-2-oxochromen-3-yl)acetate.
| Compound Name | 2-hydroxyethyl 2,2-bis(4-hydroxy-6-methyl-2-oxochromen-3-yl)acetate |
|---|---|
| PubChem CID | 59746837 |
| Molecular Formula | C24H20O9 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-hydroxyethyl 2,2-bis(4-hydroxy-6-methyl-2-oxochromen-3-yl)acetate |
| SMILES | Cc1ccc2oc(=O)c(C(C(=O)OCCO)c3c(O)c4cc(C)ccc4oc3=O)c(O)c2c1 |
| InChI | InChI=1S/C24H20O9/c1-11-3-5-15-13(9-11)20(26)18(23(29)32-15)17(22(28)31-8-7-25)19-21(27)14-10-12(2)4-6-16(14)33-24(19)30/h3-6,9-10,17,25-27H,7-8H2,1-2H3 |
| InChIKey | RRLFDLGCKHXFPT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 147.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|