C14H15NO5 — CID 142676434
N-hydroxy-3-(4-methoxy-6-methyl-2-oxochromen-3-yl)propanamide (PubChem CID 142676434) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-hydroxy-3-(4-methoxy-6-methyl-2-oxochromen-3-yl)propanamide.
| Compound Name | N-hydroxy-3-(4-methoxy-6-methyl-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 142676434 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N-hydroxy-3-(4-methoxy-6-methyl-2-oxochromen-3-yl)propanamide |
| SMILES | COc1c(CCC(=O)NO)c(=O)oc2ccc(C)cc12 |
| InChI | InChI=1S/C14H15NO5/c1-8-3-5-11-10(7-8)13(19-2)9(14(17)20-11)4-6-12(16)15-18/h3,5,7,18H,4,6H2,1-2H3,(H,15,16) |
| InChIKey | AOOMNHUIZUGMGS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|