C16H19NO5 — CID 142676428
N-hydroxy-3-(6-methyl-2-oxo-4-propan-2-yloxychromen-3-yl)propanamide (PubChem CID 142676428) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is N-hydroxy-3-(6-methyl-2-oxo-4-propan-2-yloxychromen-3-yl)propanamide.
| Compound Name | N-hydroxy-3-(6-methyl-2-oxo-4-propan-2-yloxychromen-3-yl)propanamide |
|---|---|
| PubChem CID | 142676428 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-hydroxy-3-(6-methyl-2-oxo-4-propan-2-yloxychromen-3-yl)propanamide |
| SMILES | Cc1ccc2oc(=O)c(CCC(=O)NO)c(OC(C)C)c2c1 |
| InChI | InChI=1S/C16H19NO5/c1-9(2)21-15-11(5-7-14(18)17-20)16(19)22-13-6-4-10(3)8-12(13)15/h4,6,8-9,20H,5,7H2,1-3H3,(H,17,18) |
| InChIKey | QLJWNMKBLQSIKW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|