C22H22ClNO3 — CID 24524850
N-[1-(3-chlorophenyl)ethyl]-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide (PubChem CID 24524850) has the molecular formula C22H22ClNO3 and a molecular weight of 383.88 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 24524850 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide |
| SMILES | Cc1ccc2c(C)c(CCC(=O)NC(C)c3cccc(Cl)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C22H22ClNO3/c1-13-7-8-18-14(2)19(22(26)27-20(18)11-13)9-10-21(25)24-15(3)16-5-4-6-17(23)12-16/h4-8,11-12,15H,9-10H2,1-3H3,(H,24,25) |
| InChIKey | LISOOOHLZYCSQL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|