C28H25N3O3 — CID 24621615
N-[3H-benzimidazol-5-yl(phenyl)methyl]-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide (PubChem CID 24621615) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is N-[3H-benzimidazol-5-yl(phenyl)methyl]-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide.
| Compound Name | N-[3H-benzimidazol-5-yl(phenyl)methyl]-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 24621615 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-[3H-benzimidazol-5-yl(phenyl)methyl]-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide |
| SMILES | Cc1ccc2c(C)c(CCC(=O)NC(c3ccccc3)c3ccc4nc[nH]c4c3)c(=O)oc2c1 |
| InChI | InChI=1S/C28H25N3O3/c1-17-8-10-21-18(2)22(28(33)34-25(21)14-17)11-13-26(32)31-27(19-6-4-3-5-7-19)20-9-12-23-24(15-20)30-16-29-23/h3-10,12,14-16,27H,11,13H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | DPIWFHWTRUJKKH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|