C22H21N3O3 — CID 18105229
N-(1H-benzimidazol-2-ylmethyl)-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide (PubChem CID 18105229) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 18105229 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide |
| SMILES | Cc1ccc2c(C)c(CCC(=O)NCc3nc4ccccc4[nH]3)c(=O)oc2c1 |
| InChI | InChI=1S/C22H21N3O3/c1-13-7-8-15-14(2)16(22(27)28-19(15)11-13)9-10-21(26)23-12-20-24-17-5-3-4-6-18(17)25-20/h3-8,11H,9-10,12H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | CXQKMEOBABPCGZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|