C23H32N2O3 — CID 30480392
3-(4,7-dimethyl-2-oxochromen-3-yl)-N-(2-methyl-2-piperidin-1-ylpropyl)propanamide (PubChem CID 30480392) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 3-(4,7-dimethyl-2-oxochromen-3-yl)-N-(2-methyl-2-piperidin-1-ylpropyl)propanamide.
| Compound Name | 3-(4,7-dimethyl-2-oxochromen-3-yl)-N-(2-methyl-2-piperidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 30480392 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 3-(4,7-dimethyl-2-oxochromen-3-yl)-N-(2-methyl-2-piperidin-1-ylpropyl)propanamide |
| SMILES | Cc1ccc2c(C)c(CCC(=O)NCC(C)(C)N3CCCCC3)c(=O)oc2c1 |
| InChI | InChI=1S/C23H32N2O3/c1-16-8-9-18-17(2)19(22(27)28-20(18)14-16)10-11-21(26)24-15-23(3,4)25-12-6-5-7-13-25/h8-9,14H,5-7,10-13,15H2,1-4H3,(H,24,26) |
| InChIKey | GGRXHJOTEWNMTR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|