C27H30N2O5 — CID 55693252
3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[[3-(piperidine-1-carbonyl)phenyl]methyl]propanamide (PubChem CID 55693252) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[[3-(piperidine-1-carbonyl)phenyl]methyl]propanamide.
| Compound Name | 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[[3-(piperidine-1-carbonyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 55693252 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[[3-(piperidine-1-carbonyl)phenyl]methyl]propanamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)NCc3cccc(C(=O)N4CCCCC4)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C27H30N2O5/c1-18-22-10-9-21(33-2)16-24(22)34-27(32)23(18)11-12-25(30)28-17-19-7-6-8-20(15-19)26(31)29-13-4-3-5-14-29/h6-10,15-16H,3-5,11-14,17H2,1-2H3,(H,28,30) |
| InChIKey | YEOGHMXFPFBTBR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|