C20H27N3O4 — CID 119445603
3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-(2-piperazin-1-ylethyl)propanamide (PubChem CID 119445603) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-(2-piperazin-1-ylethyl)propanamide.
| Compound Name | 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-(2-piperazin-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 119445603 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-(2-piperazin-1-ylethyl)propanamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)NCCN3CCNCC3)c(=O)oc2c1 |
| InChI | InChI=1S/C20H27N3O4/c1-14-16-4-3-15(26-2)13-18(16)27-20(25)17(14)5-6-19(24)22-9-12-23-10-7-21-8-11-23/h3-4,13,21H,5-12H2,1-2H3,(H,22,24) |
| InChIKey | KQOFGFYNKWYUMH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|