C28H35N3O4 — CID 55839692
N-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide (PubChem CID 55839692) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide.
| Compound Name | N-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 55839692 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide |
| SMILES | CCN1CCN(Cc2ccc(CNC(=O)CCc3c(C)c4ccc(OC)cc4oc3=O)cc2)CC1 |
| InChI | InChI=1S/C28H35N3O4/c1-4-30-13-15-31(16-14-30)19-22-7-5-21(6-8-22)18-29-27(32)12-11-25-20(2)24-10-9-23(34-3)17-26(24)35-28(25)33/h5-10,17H,4,11-16,18-19H2,1-3H3,(H,29,32) |
| InChIKey | STLZAOOWCQQDJN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|