C22H21BrFNO4 — CID 55898150
N-[2-(3-bromo-4-fluorophenyl)ethyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide (PubChem CID 55898150) has the molecular formula C22H21BrFNO4 and a molecular weight of 462.32 g/mol. Its IUPAC name is N-[2-(3-bromo-4-fluorophenyl)ethyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide.
| Compound Name | N-[2-(3-bromo-4-fluorophenyl)ethyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 55898150 |
| Molecular Formula | C22H21BrFNO4 |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | N-[2-(3-bromo-4-fluorophenyl)ethyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)NCCc3ccc(F)c(Br)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C22H21BrFNO4/c1-13-16-5-4-15(28-2)12-20(16)29-22(27)17(13)6-8-21(26)25-10-9-14-3-7-19(24)18(23)11-14/h3-5,7,11-12H,6,8-10H2,1-2H3,(H,25,26) |
| InChIKey | PPOIPMVZZKSUJM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|