C22H19F4NO4 — CID 55705982
N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide (PubChem CID 55705982) has the molecular formula C22H19F4NO4 and a molecular weight of 437.39 g/mol. Its IUPAC name is N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide.
| Compound Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 55705982 |
| Molecular Formula | C22H19F4NO4 |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)NCc3ccc(F)cc3C(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C22H19F4NO4/c1-12-16-6-5-15(30-2)10-19(16)31-21(29)17(12)7-8-20(28)27-11-13-3-4-14(23)9-18(13)22(24,25)26/h3-6,9-10H,7-8,11H2,1-2H3,(H,27,28) |
| InChIKey | GJZPMYJRPCTQEZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|