C21H19F3N2O5 — CID 46478105
3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide (PubChem CID 46478105) has the molecular formula C21H19F3N2O5 and a molecular weight of 436.39 g/mol. Its IUPAC name is 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide.
| Compound Name | 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 46478105 |
| Molecular Formula | C21H19F3N2O5 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)Nc3ccc(OCC(F)(F)F)nc3)c(=O)oc2c1 |
| InChI | InChI=1S/C21H19F3N2O5/c1-12-15-5-4-14(29-2)9-17(15)31-20(28)16(12)6-7-18(27)26-13-3-8-19(25-10-13)30-11-21(22,23)24/h3-5,8-10H,6-7,11H2,1-2H3,(H,26,27) |
| InChIKey | KWMKIIKSTBRBGT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|